C16H11ClN4S — CID 72895876
4-[[4-(3-chloro-1-benzothiophen-2-yl)triazol-1-yl]methyl]pyridine (PubChem CID 72895876) has the molecular formula C16H11ClN4S and a molecular weight of 326.81 g/mol. Its IUPAC name is 4-[[4-(3-chloro-1-benzothiophen-2-yl)triazol-1-yl]methyl]pyridine.
| Compound Name | 4-[[4-(3-chloro-1-benzothiophen-2-yl)triazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 72895876 |
| Molecular Formula | C16H11ClN4S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-[[4-(3-chloro-1-benzothiophen-2-yl)triazol-1-yl]methyl]pyridine |
| SMILES | Clc1c(-c2cn(Cc3ccncc3)nn2)sc2ccccc12 |
| InChI | InChI=1S/C16H11ClN4S/c17-15-12-3-1-2-4-14(12)22-16(15)13-10-21(20-19-13)9-11-5-7-18-8-6-11/h1-8,10H,9H2 |
| InChIKey | HYPMYSJZWLZULZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |