C15H25N5OS — CID 72896250
1,3-dimethyl-N-[3-(1-methylpiperidin-4-yl)oxypropyl]pyrazolo[5,4-d][1,3]thiazol-5-amine (PubChem CID 72896250) has the molecular formula C15H25N5OS and a molecular weight of 323.47 g/mol. Its IUPAC name is 1,3-dimethyl-N-[3-(1-methylpiperidin-4-yl)oxypropyl]pyrazolo[5,4-d][1,3]thiazol-5-amine.
| Compound Name | 1,3-dimethyl-N-[3-(1-methylpiperidin-4-yl)oxypropyl]pyrazolo[5,4-d][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 72896250 |
| Molecular Formula | C15H25N5OS |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1,3-dimethyl-N-[3-(1-methylpiperidin-4-yl)oxypropyl]pyrazolo[5,4-d][1,3]thiazol-5-amine |
| SMILES | Cc1nn(C)c2nc(NCCCOC3CCN(C)CC3)sc12 |
| InChI | InChI=1S/C15H25N5OS/c1-11-13-14(20(3)18-11)17-15(22-13)16-7-4-10-21-12-5-8-19(2)9-6-12/h12H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | SMDFMOYRFCBZGB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|