C8H17N2O+ — CID 7289638
(NZ)-N-[(2R,5S)-1,2,5-trimethylpiperidin-1-ium-4-ylidene]hydroxylamine (PubChem CID 7289638) has the molecular formula C8H17N2O+ and a molecular weight of 157.24 g/mol. Its IUPAC name is (NZ)-N-[(2R,5S)-1,2,5-trimethylpiperidin-1-ium-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2R,5S)-1,2,5-trimethylpiperidin-1-ium-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7289638 |
| Molecular Formula | C8H17N2O+ |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (NZ)-N-[(2R,5S)-1,2,5-trimethylpiperidin-1-ium-4-ylidene]hydroxylamine |
| SMILES | C[C@@H]1C/C(=N/O)[C@@H](C)C[NH+]1C |
| InChI | InChI=1S/C8H16N2O/c1-6-5-10(3)7(2)4-8(6)9-11/h6-7,11H,4-5H2,1-3H3/p+1/b9-8-/t6-,7+/m0/s1 |
| InChIKey | ONKISBIHPDPWJL-KNJDTQEKSA-O |
| XLogP | -0.24 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|