C18H28FN5O2 — CID 72897428
8-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]-2-(3-methoxypropyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 72897428) has the molecular formula C18H28FN5O2 and a molecular weight of 365.45 g/mol. Its IUPAC name is 8-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]-2-(3-methoxypropyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]-2-(3-methoxypropyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 72897428 |
| Molecular Formula | C18H28FN5O2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 8-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]-2-(3-methoxypropyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | COCCCN1CC2(CCN(c3ncc(F)c(N(C)C)n3)CC2)CC1=O |
| InChI | InChI=1S/C18H28FN5O2/c1-22(2)16-14(19)12-20-17(21-16)23-8-5-18(6-9-23)11-15(25)24(13-18)7-4-10-26-3/h12H,4-11,13H2,1-3H3 |
| InChIKey | PKWFYMOJRZNPHO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|