C14H23N5O2S — CID 72897473
(4aR,7aS)-1-(cyclopropylmethyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 72897473) has the molecular formula C14H23N5O2S and a molecular weight of 325.44 g/mol. Its IUPAC name is (4aR,7aS)-1-(cyclopropylmethyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-(cyclopropylmethyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 72897473 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (4aR,7aS)-1-(cyclopropylmethyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cc1nc(CN2CCN(CC3CC3)[C@@H]3CS(=O)(=O)C[C@@H]32)n[nH]1 |
| InChI | InChI=1S/C14H23N5O2S/c1-10-15-14(17-16-10)7-19-5-4-18(6-11-2-3-11)12-8-22(20,21)9-13(12)19/h11-13H,2-9H2,1H3,(H,15,16,17)/t12-,13+/m1/s1 |
| InChIKey | VCMSONLUSNHBTR-OLZOCXBDSA-N |
| XLogP | -0.19 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |