C20H23N3O4 — CID 72897658
N-[(3S,4R)-4-(4-methoxyphenyl)-1-[2-(1-methylpyrrol-2-yl)-2-oxoacetyl]pyrrolidin-3-yl]acetamide (PubChem CID 72897658) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[(3S,4R)-4-(4-methoxyphenyl)-1-[2-(1-methylpyrrol-2-yl)-2-oxoacetyl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[(3S,4R)-4-(4-methoxyphenyl)-1-[2-(1-methylpyrrol-2-yl)-2-oxoacetyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 72897658 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[(3S,4R)-4-(4-methoxyphenyl)-1-[2-(1-methylpyrrol-2-yl)-2-oxoacetyl]pyrrolidin-3-yl]acetamide |
| SMILES | COc1ccc([C@@H]2CN(C(=O)C(=O)c3cccn3C)C[C@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-13(24)21-17-12-23(20(26)19(25)18-5-4-10-22(18)2)11-16(17)14-6-8-15(27-3)9-7-14/h4-10,16-17H,11-12H2,1-3H3,(H,21,24)/t16-,17+/m0/s1 |
| InChIKey | FMIBENIKOBXOPG-DLBZAZTESA-N |
| XLogP | 1.35 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|