C16H24N2O3S — CID 72898095
1-[(4aR,8aR)-4a-hydroxy-7-(thiophen-3-ylmethyl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-2-methoxyethanone (PubChem CID 72898095) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[(4aR,8aR)-4a-hydroxy-7-(thiophen-3-ylmethyl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-2-methoxyethanone.
| Compound Name | 1-[(4aR,8aR)-4a-hydroxy-7-(thiophen-3-ylmethyl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 72898095 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-[(4aR,8aR)-4a-hydroxy-7-(thiophen-3-ylmethyl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC[C@]2(O)CCN(Cc3ccsc3)C[C@@H]2C1 |
| InChI | InChI=1S/C16H24N2O3S/c1-21-11-15(19)18-6-4-16(20)3-5-17(9-14(16)10-18)8-13-2-7-22-12-13/h2,7,12,14,20H,3-6,8-11H2,1H3/t14-,16-/m1/s1 |
| InChIKey | RKKXLCKCODFSEC-GDBMZVCRSA-N |
| XLogP | 1.18 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |