About 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide (PubChem CID 72898729) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide |
| PubChem CID | 72898729 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide |
| SMILES | Cc1n[nH]c(C)c1CCC(=O)N(C)Cc1ccoc1 |
| InChI | InChI=1S/C14H19N3O2/c1-10-13(11(2)16-15-10)4-5-14(18)17(3)8-12-6-7-19-9-12/h6-7,9H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | LNVBIACJXWULTL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide (CID 72898729) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide is Cc1n[nH]c(C)c1CCC(=O)N(C)Cc1ccoc1.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide?
The InChIKey is LNVBIACJXWULTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-10-13(11(2)16-15-10)4-5-14(18)17(3)8-12-6-7-19-9-12/h6-7,9H,4-5,8H2,1-3H3,(H,15,16).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide?
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide has a molecular weight of 261.32 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(furan-3-ylmethyl)-N-methylpropanamide is sourced from PubChem (CID 72898729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).