C13H15N7OS2 — CID 72899521
1-(2-methyl-1,3-benzothiazol-5-yl)-3-[2-(1-methyltetrazol-5-yl)sulfanylethyl]urea (PubChem CID 72899521) has the molecular formula C13H15N7OS2 and a molecular weight of 349.45 g/mol. Its IUPAC name is 1-(2-methyl-1,3-benzothiazol-5-yl)-3-[2-(1-methyltetrazol-5-yl)sulfanylethyl]urea.
| Compound Name | 1-(2-methyl-1,3-benzothiazol-5-yl)-3-[2-(1-methyltetrazol-5-yl)sulfanylethyl]urea |
|---|---|
| PubChem CID | 72899521 |
| Molecular Formula | C13H15N7OS2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-(2-methyl-1,3-benzothiazol-5-yl)-3-[2-(1-methyltetrazol-5-yl)sulfanylethyl]urea |
| SMILES | Cc1nc2cc(NC(=O)NCCSc3nnnn3C)ccc2s1 |
| InChI | InChI=1S/C13H15N7OS2/c1-8-15-10-7-9(3-4-11(10)23-8)16-12(21)14-5-6-22-13-17-18-19-20(13)2/h3-4,7H,5-6H2,1-2H3,(H2,14,16,21) |
| InChIKey | KBBLUXDEGSKZDD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|