C13H18N6S — CID 72899692
1,3-dimethyl-N-[3-(2-methylimidazol-1-yl)propyl]pyrazolo[5,4-d][1,3]thiazol-5-amine (PubChem CID 72899692) has the molecular formula C13H18N6S and a molecular weight of 290.40 g/mol. Its IUPAC name is 1,3-dimethyl-N-[3-(2-methylimidazol-1-yl)propyl]pyrazolo[5,4-d][1,3]thiazol-5-amine.
| Compound Name | 1,3-dimethyl-N-[3-(2-methylimidazol-1-yl)propyl]pyrazolo[5,4-d][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 72899692 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1,3-dimethyl-N-[3-(2-methylimidazol-1-yl)propyl]pyrazolo[5,4-d][1,3]thiazol-5-amine |
| SMILES | Cc1nn(C)c2nc(NCCCn3ccnc3C)sc12 |
| InChI | InChI=1S/C13H18N6S/c1-9-11-12(18(3)17-9)16-13(20-11)15-5-4-7-19-8-6-14-10(19)2/h6,8H,4-5,7H2,1-3H3,(H,15,16) |
| InChIKey | NFNQWCAYPFBLKE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|