C17H20N6O4 — CID 72900859
N-[(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-yl]-2-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide (PubChem CID 72900859) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is N-[(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-yl]-2-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide.
| Compound Name | N-[(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-yl]-2-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 72900859 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-yl]-2-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide |
| SMILES | Cc1cc(C[C@@H]2COC[C@@H]2NC(=O)Cc2nc3nc(C)cc(=O)n3[nH]2)on1 |
| InChI | InChI=1S/C17H20N6O4/c1-9-4-16(25)23-17(18-9)20-14(21-23)6-15(24)19-13-8-26-7-11(13)5-12-3-10(2)22-27-12/h3-4,11,13H,5-8H2,1-2H3,(H,19,24)(H,18,20,21)/t11-,13+/m1/s1 |
| InChIKey | BQSDVZHFFFGTAS-YPMHNXCESA-N |
| XLogP | -0.06 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |