About (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol
(4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol (PubChem CID 72900865) has the molecular formula C16H28N4O2
and a molecular weight of 308.43 g/mol. Its IUPAC name is (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol |
| PubChem CID | 72900865 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol |
| SMILES | COC[C@]1(O)CCN(Cc2cnc(N(C)C)nc2)CC1(C)C |
| InChI | InChI=1S/C16H28N4O2/c1-15(2)11-20(7-6-16(15,21)12-22-5)10-13-8-17-14(18-9-13)19(3)4/h8-9,21H,6-7,10-12H2,1-5H3/t16-/m1/s1 |
| InChIKey | ISWQGBZEEJUZJX-MRXNPFEDSA-N |
| XLogP | 1.15 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol?
The IUPAC name of (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol (CID 72900865) is (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol.
What is the SMILES notation for (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol?
The canonical SMILES for (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol is COC[C@]1(O)CCN(Cc2cnc(N(C)C)nc2)CC1(C)C.
What is the InChIKey of (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol?
The InChIKey is ISWQGBZEEJUZJX-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H28N4O2/c1-15(2)11-20(7-6-16(15,21)12-22-5)10-13-8-17-14(18-9-13)19(3)4/h8-9,21H,6-7,10-12H2,1-5H3/t16-/m1/s1.
What are the key properties of (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol?
(4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol has a molecular weight of 308.43 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol is sourced from PubChem (CID 72900865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).