C17H24N2O4 — CID 72902474
N-(5-acetyl-2-ethoxyphenyl)-2-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 72902474) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(5-acetyl-2-ethoxyphenyl)-2-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-(5-acetyl-2-ethoxyphenyl)-2-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 72902474 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-(5-acetyl-2-ethoxyphenyl)-2-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | CCOc1ccc(C(C)=O)cc1NC(=O)N1CCCCC1CO |
| InChI | InChI=1S/C17H24N2O4/c1-3-23-16-8-7-13(12(2)21)10-15(16)18-17(22)19-9-5-4-6-14(19)11-20/h7-8,10,14,20H,3-6,9,11H2,1-2H3,(H,18,22) |
| InChIKey | UDDLGBVQTUSHKG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |