C16H17N3O2 — CID 72902515
6-(2,6-dimethoxyphenyl)-2-ethyl-1H-imidazo[4,5-b]pyridine (PubChem CID 72902515) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 6-(2,6-dimethoxyphenyl)-2-ethyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 6-(2,6-dimethoxyphenyl)-2-ethyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 72902515 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 6-(2,6-dimethoxyphenyl)-2-ethyl-1H-imidazo[4,5-b]pyridine |
| SMILES | CCc1nc2ncc(-c3c(OC)cccc3OC)cc2[nH]1 |
| InChI | InChI=1S/C16H17N3O2/c1-4-14-18-11-8-10(9-17-16(11)19-14)15-12(20-2)6-5-7-13(15)21-3/h5-9H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | UVKATBQJDMNSHB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |