C23H32N4O — CID 72903798
1-[3-[1-(cyclopropylmethyl)imidazol-2-yl]piperidin-1-yl]-3-[4-(dimethylamino)phenyl]propan-1-one (PubChem CID 72903798) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 1-[3-[1-(cyclopropylmethyl)imidazol-2-yl]piperidin-1-yl]-3-[4-(dimethylamino)phenyl]propan-1-one.
| Compound Name | 1-[3-[1-(cyclopropylmethyl)imidazol-2-yl]piperidin-1-yl]-3-[4-(dimethylamino)phenyl]propan-1-one |
|---|---|
| PubChem CID | 72903798 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 1-[3-[1-(cyclopropylmethyl)imidazol-2-yl]piperidin-1-yl]-3-[4-(dimethylamino)phenyl]propan-1-one |
| SMILES | CN(C)c1ccc(CCC(=O)N2CCCC(c3nccn3CC3CC3)C2)cc1 |
| InChI | InChI=1S/C23H32N4O/c1-25(2)21-10-7-18(8-11-21)9-12-22(28)26-14-3-4-20(17-26)23-24-13-15-27(23)16-19-5-6-19/h7-8,10-11,13,15,19-20H,3-6,9,12,14,16-17H2,1-2H3 |
| InChIKey | TUKZBNRQWNDKQE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|