About 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine
6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine (PubChem CID 72904160) has the molecular formula C19H19N3O2
and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine |
| PubChem CID | 72904160 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine |
| SMILES | COc1ccc2c(c1)OCC(Cc1ccc3ncnc(N)c3c1)C2 |
| InChI | InChI=1S/C19H19N3O2/c1-23-15-4-3-14-7-13(10-24-18(14)9-15)6-12-2-5-17-16(8-12)19(20)22-11-21-17/h2-5,8-9,11,13H,6-7,10H2,1H3,(H2,20,21,22) |
| InChIKey | RRZODNYLQXQYMJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine?
The IUPAC name of 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine (CID 72904160) is 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine.
What is the SMILES notation for 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine?
The canonical SMILES for 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine is COc1ccc2c(c1)OCC(Cc1ccc3ncnc(N)c3c1)C2.
What is the InChIKey of 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine?
The InChIKey is RRZODNYLQXQYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2/c1-23-15-4-3-14-7-13(10-24-18(14)9-15)6-12-2-5-17-16(8-12)19(20)22-11-21-17/h2-5,8-9,11,13H,6-7,10H2,1H3,(H2,20,21,22).
What are the key properties of 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine?
6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine has a molecular weight of 321.38 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]quinazolin-4-amine is sourced from PubChem (CID 72904160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).