C18H25ClN4O — CID 72904285
N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-(1-methylpiperidin-3-yl)propanamide (PubChem CID 72904285) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-(1-methylpiperidin-3-yl)propanamide.
| Compound Name | N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-(1-methylpiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 72904285 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-(1-methylpiperidin-3-yl)propanamide |
| SMILES | CN1CCCC(CCC(=O)NCCc2nc3ccc(Cl)cc3[nH]2)C1 |
| InChI | InChI=1S/C18H25ClN4O/c1-23-10-2-3-13(12-23)4-7-18(24)20-9-8-17-21-15-6-5-14(19)11-16(15)22-17/h5-6,11,13H,2-4,7-10,12H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | ZAFHQDDQTAXCLW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |