About (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol
(3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol (PubChem CID 72904453) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol |
| PubChem CID | 72904453 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol |
| SMILES | C[C@@H]1CN(Cc2ccncc2)C[C@]1(C)O |
| InChI | InChI=1S/C12H18N2O/c1-10-7-14(9-12(10,2)15)8-11-3-5-13-6-4-11/h3-6,10,15H,7-9H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | MRDNEAWUFVZRQH-PWSUYJOCSA-N |
| XLogP | 1.28 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol?
The IUPAC name of (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol (CID 72904453) is (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol.
What is the SMILES notation for (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol?
The canonical SMILES for (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol is C[C@@H]1CN(Cc2ccncc2)C[C@]1(C)O.
What is the InChIKey of (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol?
The InChIKey is MRDNEAWUFVZRQH-PWSUYJOCSA-N. The full InChI is InChI=1S/C12H18N2O/c1-10-7-14(9-12(10,2)15)8-11-3-5-13-6-4-11/h3-6,10,15H,7-9H2,1-2H3/t10-,12+/m1/s1.
What are the key properties of (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol?
(3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol has a molecular weight of 206.29 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3,4-dimethyl-1-(pyridin-4-ylmethyl)pyrrolidin-3-ol is sourced from PubChem (CID 72904453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).