C20H23N3O4 — CID 72905468
4-[2-[(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-2-oxoethyl]-1-methyl-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 72905468) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[2-[(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-2-oxoethyl]-1-methyl-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 4-[2-[(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-2-oxoethyl]-1-methyl-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 72905468 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-[2-[(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-2-oxoethyl]-1-methyl-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | CN1C(=O)CN(CC(=O)N2C[C@@H]3[C@H](C2)[C@H]2CC[C@@H]3O2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H23N3O4/c1-21-15-5-3-2-4-12(15)20(26)23(10-18(21)24)11-19(25)22-8-13-14(9-22)17-7-6-16(13)27-17/h2-5,13-14,16-17H,6-11H2,1H3/t13-,14+,16+,17- |
| InChIKey | NZKNZSAQMGWJJW-ULAZLLGUSA-N |
| XLogP | 0.74 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |