C21H25N3O4 — CID 72905508
N-(1-benzyl-5-oxopyrrolidin-3-yl)-5-(morpholin-4-ylmethyl)furan-3-carboxamide (PubChem CID 72905508) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(1-benzyl-5-oxopyrrolidin-3-yl)-5-(morpholin-4-ylmethyl)furan-3-carboxamide.
| Compound Name | N-(1-benzyl-5-oxopyrrolidin-3-yl)-5-(morpholin-4-ylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 72905508 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-(1-benzyl-5-oxopyrrolidin-3-yl)-5-(morpholin-4-ylmethyl)furan-3-carboxamide |
| SMILES | O=C(NC1CC(=O)N(Cc2ccccc2)C1)c1coc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C21H25N3O4/c25-20-11-18(13-24(20)12-16-4-2-1-3-5-16)22-21(26)17-10-19(28-15-17)14-23-6-8-27-9-7-23/h1-5,10,15,18H,6-9,11-14H2,(H,22,26) |
| InChIKey | HEPUHUOFRPVRGR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |