C20H26N4OS — CID 72905582
(5-methylspiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,4'-piperidine]-1'-yl)-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methanone (PubChem CID 72905582) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is (5-methylspiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,4'-piperidine]-1'-yl)-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methanone.
| Compound Name | (5-methylspiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,4'-piperidine]-1'-yl)-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 72905582 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (5-methylspiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,4'-piperidine]-1'-yl)-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methanone |
| SMILES | CN1CCc2[nH]cnc2C12CCN(C(=O)c1csc3c1CCCC3)CC2 |
| InChI | InChI=1S/C20H26N4OS/c1-23-9-6-16-18(22-13-21-16)20(23)7-10-24(11-8-20)19(25)15-12-26-17-5-3-2-4-14(15)17/h12-13H,2-11H2,1H3,(H,21,22) |
| InChIKey | MGJVLJKYCJTQMI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |