About 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole
1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole (PubChem CID 72906903) has the molecular formula C14H29N7O2S
and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole.
Molecular Properties
| Compound Name | 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole |
| PubChem CID | 72906903 |
| Molecular Formula | C14H29N7O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole |
| SMILES | CCC[C@H]1CN(CCCn2nnnc2C)C[C@@H]1NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C14H29N7O2S/c1-5-7-13-10-20(8-6-9-21-12(2)15-17-18-21)11-14(13)16-24(22,23)19(3)4/h13-14,16H,5-11H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | UDIGTUHTDNJPSO-KBPBESRZSA-N |
| XLogP | -0.13 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole?
The IUPAC name of 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole (CID 72906903) is 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole.
What is the SMILES notation for 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole?
The canonical SMILES for 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole is CCC[C@H]1CN(CCCn2nnnc2C)C[C@@H]1NS(=O)(=O)N(C)C.
What is the InChIKey of 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole?
The InChIKey is UDIGTUHTDNJPSO-KBPBESRZSA-N. The full InChI is InChI=1S/C14H29N7O2S/c1-5-7-13-10-20(8-6-9-21-12(2)15-17-18-21)11-14(13)16-24(22,23)19(3)4/h13-14,16H,5-11H2,1-4H3/t13-,14-/m0/s1.
What are the key properties of 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole?
1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole has a molecular weight of 359.50 g/mol, XLogP of -0.13, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(3R,4S)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]propyl]-5-methyltetrazole is sourced from PubChem (CID 72906903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).