About [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol
[1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol (PubChem CID 72906961) has the molecular formula C15H26N4O
and a molecular weight of 278.40 g/mol. Its IUPAC name is [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol |
| PubChem CID | 72906961 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol |
| SMILES | Cc1ncnc(NCCCN2CCCCC2CO)c1C |
| InChI | InChI=1S/C15H26N4O/c1-12-13(2)17-11-18-15(12)16-7-5-9-19-8-4-3-6-14(19)10-20/h11,14,20H,3-10H2,1-2H3,(H,16,17,18) |
| InChIKey | YJBRXXQFSCNQRV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol?
The IUPAC name of [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol (CID 72906961) is [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol.
What is the SMILES notation for [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol?
The canonical SMILES for [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol is Cc1ncnc(NCCCN2CCCCC2CO)c1C.
What is the InChIKey of [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol?
The InChIKey is YJBRXXQFSCNQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O/c1-12-13(2)17-11-18-15(12)16-7-5-9-19-8-4-3-6-14(19)10-20/h11,14,20H,3-10H2,1-2H3,(H,16,17,18).
What are the key properties of [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol?
[1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol has a molecular weight of 278.40 g/mol, XLogP of 1.74, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-[(5,6-dimethylpyrimidin-4-yl)amino]propyl]piperidin-2-yl]methanol is sourced from PubChem (CID 72906961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).