C18H21NO4 — CID 7290736
7-[(2R)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]oxychromen-2-one (PubChem CID 7290736) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 7-[(2R)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]oxychromen-2-one.
| Compound Name | 7-[(2R)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 7290736 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 7-[(2R)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl]oxychromen-2-one |
| SMILES | CC1CCN(C(=O)[C@@H](C)Oc2ccc3ccc(=O)oc3c2)CC1 |
| InChI | InChI=1S/C18H21NO4/c1-12-7-9-19(10-8-12)18(21)13(2)22-15-5-3-14-4-6-17(20)23-16(14)11-15/h3-6,11-13H,7-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | YDFVLRNROOZYKW-CYBMUJFWSA-N |
| XLogP | 2.82 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|