C15H18ClFN4O — CID 72908654
N-[2-(4-chloropyrazol-1-yl)ethyl]-2-(dimethylamino)-2-(4-fluorophenyl)acetamide (PubChem CID 72908654) has the molecular formula C15H18ClFN4O and a molecular weight of 324.79 g/mol. Its IUPAC name is N-[2-(4-chloropyrazol-1-yl)ethyl]-2-(dimethylamino)-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-(4-chloropyrazol-1-yl)ethyl]-2-(dimethylamino)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 72908654 |
| Molecular Formula | C15H18ClFN4O |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[2-(4-chloropyrazol-1-yl)ethyl]-2-(dimethylamino)-2-(4-fluorophenyl)acetamide |
| SMILES | CN(C)C(C(=O)NCCn1cc(Cl)cn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18ClFN4O/c1-20(2)14(11-3-5-13(17)6-4-11)15(22)18-7-8-21-10-12(16)9-19-21/h3-6,9-10,14H,7-8H2,1-2H3,(H,18,22) |
| InChIKey | PXGMRAFVJXLMDO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |