C22H32N2O2 — CID 72908778
N,N-dimethyl-3-[[5-methyl-5-(4-methylpent-3-enyl)-2-oxopiperidin-1-yl]methyl]benzamide (PubChem CID 72908778) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N,N-dimethyl-3-[[5-methyl-5-(4-methylpent-3-enyl)-2-oxopiperidin-1-yl]methyl]benzamide.
| Compound Name | N,N-dimethyl-3-[[5-methyl-5-(4-methylpent-3-enyl)-2-oxopiperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 72908778 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | N,N-dimethyl-3-[[5-methyl-5-(4-methylpent-3-enyl)-2-oxopiperidin-1-yl]methyl]benzamide |
| SMILES | CC(C)=CCCC1(C)CCC(=O)N(Cc2cccc(C(=O)N(C)C)c2)C1 |
| InChI | InChI=1S/C22H32N2O2/c1-17(2)8-7-12-22(3)13-11-20(25)24(16-22)15-18-9-6-10-19(14-18)21(26)23(4)5/h6,8-10,14H,7,11-13,15-16H2,1-5H3 |
| InChIKey | KOXHSZCGQROUIR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|