About 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile
6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile (PubChem CID 72908914) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile |
| PubChem CID | 72908914 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)cn2)C[C@@]1(O)C1CC1 |
| InChI | InChI=1S/C14H17N3O/c1-10-8-17(9-14(10,18)12-3-4-12)13-5-2-11(6-15)7-16-13/h2,5,7,10,12,18H,3-4,8-9H2,1H3/t10-,14+/m1/s1 |
| InChIKey | JVXRRTKBJUJIKY-YGRLFVJLSA-N |
| XLogP | 1.55 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile?
The IUPAC name of 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile (CID 72908914) is 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile?
The canonical SMILES for 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile is C[C@@H]1CN(c2ccc(C#N)cn2)C[C@@]1(O)C1CC1.
What is the InChIKey of 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile?
The InChIKey is JVXRRTKBJUJIKY-YGRLFVJLSA-N. The full InChI is InChI=1S/C14H17N3O/c1-10-8-17(9-14(10,18)12-3-4-12)13-5-2-11(6-15)7-16-13/h2,5,7,10,12,18H,3-4,8-9H2,1H3/t10-,14+/m1/s1.
What are the key properties of 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile?
6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile has a molecular weight of 243.31 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3R,4R)-3-cyclopropyl-3-hydroxy-4-methylpyrrolidin-1-yl]pyridine-3-carbonitrile is sourced from PubChem (CID 72908914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).