About N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine
N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 72909743) has the molecular formula C13H9F3N6S
and a molecular weight of 338.32 g/mol. Its IUPAC name is N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 72909743 |
| Molecular Formula | C13H9F3N6S |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccnc(NCc2csc(-c3cnccn3)n2)n1 |
| InChI | InChI=1S/C13H9F3N6S/c14-13(15,16)10-1-2-19-12(22-10)20-5-8-7-23-11(21-8)9-6-17-3-4-18-9/h1-4,6-7H,5H2,(H,19,20,22) |
| InChIKey | KOVCRLFSTPNDNR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine (CID 72909743) is N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine is FC(F)(F)c1ccnc(NCc2csc(-c3cnccn3)n2)n1.
What is the InChIKey of N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is KOVCRLFSTPNDNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F3N6S/c14-13(15,16)10-1-2-19-12(22-10)20-5-8-7-23-11(21-8)9-6-17-3-4-18-9/h1-4,6-7H,5H2,(H,19,20,22).
What are the key properties of N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine?
N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 338.32 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-4-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 72909743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).