C14H21N5O3 — CID 72909858
N-ethyl-2-[4-(2-methyl-6-oxo-1H-pyrimidine-5-carbonyl)piperazin-1-yl]acetamide (PubChem CID 72909858) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-ethyl-2-[4-(2-methyl-6-oxo-1H-pyrimidine-5-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-ethyl-2-[4-(2-methyl-6-oxo-1H-pyrimidine-5-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 72909858 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-ethyl-2-[4-(2-methyl-6-oxo-1H-pyrimidine-5-carbonyl)piperazin-1-yl]acetamide |
| SMILES | CCNC(=O)CN1CCN(C(=O)c2cnc(C)[nH]c2=O)CC1 |
| InChI | InChI=1S/C14H21N5O3/c1-3-15-12(20)9-18-4-6-19(7-5-18)14(22)11-8-16-10(2)17-13(11)21/h8H,3-7,9H2,1-2H3,(H,15,20)(H,16,17,21) |
| InChIKey | UZCDKURMIFXUNL-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |