About 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide
2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide (PubChem CID 72911978) has the molecular formula C16H18N6O
and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide |
| PubChem CID | 72911978 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide |
| SMILES | Cn1cc(CCc2nc(CC(N)=O)nn2-c2ccccc2)cn1 |
| InChI | InChI=1S/C16H18N6O/c1-21-11-12(10-18-21)7-8-16-19-15(9-14(17)23)20-22(16)13-5-3-2-4-6-13/h2-6,10-11H,7-9H2,1H3,(H2,17,23) |
| InChIKey | KJIJNWHUVYOCRH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide?
The IUPAC name of 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide (CID 72911978) is 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide.
What is the SMILES notation for 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide?
The canonical SMILES for 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide is Cn1cc(CCc2nc(CC(N)=O)nn2-c2ccccc2)cn1.
What is the InChIKey of 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide?
The InChIKey is KJIJNWHUVYOCRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N6O/c1-21-11-12(10-18-21)7-8-16-19-15(9-14(17)23)20-22(16)13-5-3-2-4-6-13/h2-6,10-11H,7-9H2,1H3,(H2,17,23).
What are the key properties of 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide?
2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide has a molecular weight of 310.36 g/mol, XLogP of 0.81, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[2-(1-methylpyrazol-4-yl)ethyl]-1-phenyl-1,2,4-triazol-3-yl]acetamide is sourced from PubChem (CID 72911978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).