C14H11ClFNO2S — CID 72912555
(3-chloro-4-fluoro-1-benzothiophen-2-yl)-[2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]methanone (PubChem CID 72912555) has the molecular formula C14H11ClFNO2S and a molecular weight of 311.77 g/mol. Its IUPAC name is (3-chloro-4-fluoro-1-benzothiophen-2-yl)-[2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]methanone.
| Compound Name | (3-chloro-4-fluoro-1-benzothiophen-2-yl)-[2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 72912555 |
| Molecular Formula | C14H11ClFNO2S |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (3-chloro-4-fluoro-1-benzothiophen-2-yl)-[2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]methanone |
| SMILES | O=C(c1sc2cccc(F)c2c1Cl)N1CC=CC1CO |
| InChI | InChI=1S/C14H11ClFNO2S/c15-12-11-9(16)4-1-5-10(11)20-13(12)14(19)17-6-2-3-8(17)7-18/h1-5,8,18H,6-7H2 |
| InChIKey | HOLZIDDDNVMNLI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|