About 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole
1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole (PubChem CID 72912847) has the molecular formula C20H18N6O
and a molecular weight of 358.41 g/mol. Its IUPAC name is 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole |
| PubChem CID | 72912847 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole |
| SMILES | c1coc(-c2ncc(-c3cn(CCN4CCc5ccccc54)nn3)cn2)c1 |
| InChI | InChI=1S/C20H18N6O/c1-2-5-18-15(4-1)7-8-25(18)9-10-26-14-17(23-24-26)16-12-21-20(22-13-16)19-6-3-11-27-19/h1-6,11-14H,7-10H2 |
| InChIKey | OQZMSAVHKXYJAI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole?
The IUPAC name of 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole (CID 72912847) is 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole.
What is the SMILES notation for 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole?
The canonical SMILES for 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole is c1coc(-c2ncc(-c3cn(CCN4CCc5ccccc54)nn3)cn2)c1.
What is the InChIKey of 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole?
The InChIKey is OQZMSAVHKXYJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N6O/c1-2-5-18-15(4-1)7-8-25(18)9-10-26-14-17(23-24-26)16-12-21-20(22-13-16)19-6-3-11-27-19/h1-6,11-14H,7-10H2.
What are the key properties of 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole?
1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole has a molecular weight of 358.41 g/mol, XLogP of 3.06, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4-[2-(furan-2-yl)pyrimidin-5-yl]triazol-1-yl]ethyl]-2,3-dihydroindole is sourced from PubChem (CID 72912847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).