C13H16ClNO6 — CID 7291295
4-chloro-2-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoic acid (PubChem CID 7291295) has the molecular formula C13H16ClNO6 and a molecular weight of 317.73 g/mol. Its IUPAC name is 4-chloro-2-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 7291295 |
| Molecular Formula | C13H16ClNO6 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-chloro-2-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]amino]benzoic acid |
| SMILES | C[C@H]1O[C@@H](Nc2cc(Cl)ccc2C(=O)O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16ClNO6/c1-5-9(16)10(17)11(18)12(21-5)15-8-4-6(14)2-3-7(8)13(19)20/h2-5,9-12,15-18H,1H3,(H,19,20)/t5-,9+,10+,11+,12-/m1/s1 |
| InChIKey | IOBCYGJFFBZLHE-NWOINBQQSA-N |
| XLogP | 0.28 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |