C22H23FN6O — CID 7291311
1-[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-[5-(2-fluorophenyl)tetrazol-2-yl]ethanone (PubChem CID 7291311) has the molecular formula C22H23FN6O and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-[5-(2-fluorophenyl)tetrazol-2-yl]ethanone.
| Compound Name | 1-[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-[5-(2-fluorophenyl)tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 7291311 |
| Molecular Formula | C22H23FN6O |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-2-[5-(2-fluorophenyl)tetrazol-2-yl]ethanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CC[C@H]1N2C(=O)Cn1nnc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C22H23FN6O/c1-14-7-8-19-16(11-14)17-12-27(2)10-9-20(17)29(19)21(30)13-28-25-22(24-26-28)15-5-3-4-6-18(15)23/h3-8,11,17,20H,9-10,12-13H2,1-2H3/t17-,20+/m0/s1 |
| InChIKey | FSCVDPOZJLMSOL-FXAWDEMLSA-N |
| XLogP | 2.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |