C16H18F3N7 — CID 72913401
5-[5-(cyclopropylmethyl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 72913401) has the molecular formula C16H18F3N7 and a molecular weight of 365.36 g/mol. Its IUPAC name is 5-[5-(cyclopropylmethyl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-[5-(cyclopropylmethyl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 72913401 |
| Molecular Formula | C16H18F3N7 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 5-[5-(cyclopropylmethyl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CC(C)c1cc(-c2nc(CC3CC3)nn2CC(F)(F)F)nc2ncnn12 |
| InChI | InChI=1S/C16H18F3N7/c1-9(2)12-6-11(22-15-20-8-21-26(12)15)14-23-13(5-10-3-4-10)24-25(14)7-16(17,18)19/h6,8-10H,3-5,7H2,1-2H3 |
| InChIKey | MIBPVCNRMZJHHN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |