C13H15N3O2 — CID 72913467
(1S,2S)-1-phenyl-2-(pyrimidin-4-ylamino)propane-1,3-diol (PubChem CID 72913467) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is (1S,2S)-1-phenyl-2-(pyrimidin-4-ylamino)propane-1,3-diol.
| Compound Name | (1S,2S)-1-phenyl-2-(pyrimidin-4-ylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 72913467 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (1S,2S)-1-phenyl-2-(pyrimidin-4-ylamino)propane-1,3-diol |
| SMILES | OC[C@H](Nc1ccncn1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H15N3O2/c17-8-11(16-12-6-7-14-9-15-12)13(18)10-4-2-1-3-5-10/h1-7,9,11,13,17-18H,8H2,(H,14,15,16)/t11-,13-/m0/s1 |
| InChIKey | KTTBEKZXKLKMNY-AAEUAGOBSA-N |
| XLogP | 0.98 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |