C12H21N5OS — CID 72913599
(4aS,8aS)-7-[3-(dimethylamino)-1,2,4-thiadiazol-5-yl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol (PubChem CID 72913599) has the molecular formula C12H21N5OS and a molecular weight of 283.40 g/mol. Its IUPAC name is (4aS,8aS)-7-[3-(dimethylamino)-1,2,4-thiadiazol-5-yl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol.
| Compound Name | (4aS,8aS)-7-[3-(dimethylamino)-1,2,4-thiadiazol-5-yl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
|---|---|
| PubChem CID | 72913599 |
| Molecular Formula | C12H21N5OS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (4aS,8aS)-7-[3-(dimethylamino)-1,2,4-thiadiazol-5-yl]-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
| SMILES | CN(C)c1nsc(N2CC[C@@]3(O)CCNC[C@H]3C2)n1 |
| InChI | InChI=1S/C12H21N5OS/c1-16(2)10-14-11(19-15-10)17-6-4-12(18)3-5-13-7-9(12)8-17/h9,13,18H,3-8H2,1-2H3/t9-,12-/m0/s1 |
| InChIKey | YKCVEZAJFNARGB-CABZTGNLSA-N |
| XLogP | 0.15 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |