C15H27N5O2S — CID 72913758
(4aS,7aR)-1-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-methylpropyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 72913758) has the molecular formula C15H27N5O2S and a molecular weight of 341.48 g/mol. Its IUPAC name is (4aS,7aR)-1-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-methylpropyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-1-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-methylpropyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 72913758 |
| Molecular Formula | C15H27N5O2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (4aS,7aR)-1-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-methylpropyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cc1nc(CN2CCN(CC(C)C)[C@@H]3CS(=O)(=O)C[C@@H]32)n(C)n1 |
| InChI | InChI=1S/C15H27N5O2S/c1-11(2)7-19-5-6-20(8-15-16-12(3)17-18(15)4)14-10-23(21,22)9-13(14)19/h11,13-14H,5-10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | SHPOEWPZQLLJNK-KGLIPLIRSA-N |
| XLogP | 0.06 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |