About N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine
N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine (PubChem CID 72914146) has the molecular formula C14H19N5
and a molecular weight of 257.34 g/mol. Its IUPAC name is N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine |
| PubChem CID | 72914146 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine |
| SMILES | CCc1cnc(NCCc2nc(C)cc(C)n2)nc1 |
| InChI | InChI=1S/C14H19N5/c1-4-12-8-16-14(17-9-12)15-6-5-13-18-10(2)7-11(3)19-13/h7-9H,4-6H2,1-3H3,(H,15,16,17) |
| InChIKey | KWRZNXPCPIZZOQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine?
The IUPAC name of N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine (CID 72914146) is N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine.
What is the SMILES notation for N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine?
The canonical SMILES for N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine is CCc1cnc(NCCc2nc(C)cc(C)n2)nc1.
What is the InChIKey of N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine?
The InChIKey is KWRZNXPCPIZZOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5/c1-4-12-8-16-14(17-9-12)15-6-5-13-18-10(2)7-11(3)19-13/h7-9H,4-6H2,1-3H3,(H,15,16,17).
What are the key properties of N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine?
N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine has a molecular weight of 257.34 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,6-dimethylpyrimidin-2-yl)ethyl]-5-ethylpyrimidin-2-amine is sourced from PubChem (CID 72914146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).