About 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide
1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide (PubChem CID 72914691) has the molecular formula C18H21N5O2S
and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide |
| PubChem CID | 72914691 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide |
| SMILES | Cc1nc(CNC(=O)c2ccc3c(c2)nc(N2CCOCC2)n3C)cs1 |
| InChI | InChI=1S/C18H21N5O2S/c1-12-20-14(11-26-12)10-19-17(24)13-3-4-16-15(9-13)21-18(22(16)2)23-5-7-25-8-6-23/h3-4,9,11H,5-8,10H2,1-2H3,(H,19,24) |
| InChIKey | NKMMYRYBNQESNB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide?
The IUPAC name of 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide (CID 72914691) is 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide.
What is the SMILES notation for 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide?
The canonical SMILES for 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide is Cc1nc(CNC(=O)c2ccc3c(c2)nc(N2CCOCC2)n3C)cs1.
What is the InChIKey of 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide?
The InChIKey is NKMMYRYBNQESNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O2S/c1-12-20-14(11-26-12)10-19-17(24)13-3-4-16-15(9-13)21-18(22(16)2)23-5-7-25-8-6-23/h3-4,9,11H,5-8,10H2,1-2H3,(H,19,24).
What are the key properties of 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide?
1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide has a molecular weight of 371.47 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-morpholin-4-ylbenzimidazole-5-carboxamide is sourced from PubChem (CID 72914691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).