About 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole
1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole (PubChem CID 72914713) has the molecular formula C12H23N7O3S
and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole.
Molecular Properties
| Compound Name | 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole |
| PubChem CID | 72914713 |
| Molecular Formula | C12H23N7O3S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole |
| SMILES | CC(C)[C@@H]1CN(C(=O)Cn2cnnn2)C[C@H]1NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H23N7O3S/c1-9(2)10-5-18(12(20)7-19-8-13-15-16-19)6-11(10)14-23(21,22)17(3)4/h8-11,14H,5-7H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | BKOLVFUJTXJXHC-WDEREUQCSA-N |
| XLogP | -1.45 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole?
The IUPAC name of 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole (CID 72914713) is 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole.
What is the SMILES notation for 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole?
The canonical SMILES for 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole is CC(C)[C@@H]1CN(C(=O)Cn2cnnn2)C[C@H]1NS(=O)(=O)N(C)C.
What is the InChIKey of 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole?
The InChIKey is BKOLVFUJTXJXHC-WDEREUQCSA-N. The full InChI is InChI=1S/C12H23N7O3S/c1-9(2)10-5-18(12(20)7-19-8-13-15-16-19)6-11(10)14-23(21,22)17(3)4/h8-11,14H,5-7H2,1-4H3/t10-,11+/m0/s1.
What are the key properties of 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole?
1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole has a molecular weight of 345.43 g/mol, XLogP of -1.45, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]tetrazole is sourced from PubChem (CID 72914713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).