About 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea
1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea (PubChem CID 72914943) has the molecular formula C14H18ClN3O2
and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea.
Molecular Properties
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea |
| PubChem CID | 72914943 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NC2CCN(C)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-8-6-9(2)12(10(15)7-8)17-14(20)16-11-4-5-18(3)13(11)19/h6-7,11H,4-5H2,1-3H3,(H2,16,17,20) |
| InChIKey | NRWXFFJMDDGZBS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea?
The IUPAC name of 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea (CID 72914943) is 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea.
What is the SMILES notation for 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea?
The canonical SMILES for 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea is Cc1cc(C)c(NC(=O)NC2CCN(C)C2=O)c(Cl)c1.
What is the InChIKey of 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea?
The InChIKey is NRWXFFJMDDGZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3O2/c1-8-6-9(2)12(10(15)7-8)17-14(20)16-11-4-5-18(3)13(11)19/h6-7,11H,4-5H2,1-3H3,(H2,16,17,20).
What are the key properties of 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea?
1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea has a molecular weight of 295.77 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-4,6-dimethylphenyl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea is sourced from PubChem (CID 72914943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).