C20H26N3O3S+ — CID 7291581
(1R,3S,3aS,6aS)-1'-methyl-1-(2-methylsulfanylethyl)-5-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione (PubChem CID 7291581) has the molecular formula C20H26N3O3S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is (1R,3S,3aS,6aS)-1'-methyl-1-(2-methylsulfanylethyl)-5-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aS,6aS)-1'-methyl-1-(2-methylsulfanylethyl)-5-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7291581 |
| Molecular Formula | C20H26N3O3S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (1R,3S,3aS,6aS)-1'-methyl-1-(2-methylsulfanylethyl)-5-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-indole]-2',4,6-trione |
| SMILES | CSCC[C@H]1[NH2+][C@@]2(C(=O)N(C)c3ccccc32)[C@H]2C(=O)N(C(C)C)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H25N3O3S/c1-11(2)23-17(24)15-13(9-10-27-4)21-20(16(15)18(23)25)12-7-5-6-8-14(12)22(3)19(20)26/h5-8,11,13,15-16,21H,9-10H2,1-4H3/p+1/t13-,15-,16-,20-/m1/s1 |
| InChIKey | LXNBVGNNHRSPEL-KHTYJDQRSA-O |
| XLogP | 0.57 |
| TPSA | 74.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|