C14H18F3N3O3 — CID 72915999
3-(2-methoxyethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-3-carboxylic acid (PubChem CID 72915999) has the molecular formula C14H18F3N3O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-3-carboxylic acid.
| Compound Name | 3-(2-methoxyethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72915999 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-(2-methoxyethyl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-3-carboxylic acid |
| SMILES | COCCC1(C(=O)O)CCCN(c2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C14H18F3N3O3/c1-23-8-5-13(11(21)22)4-2-7-20(9-13)12-18-6-3-10(19-12)14(15,16)17/h3,6H,2,4-5,7-9H2,1H3,(H,21,22) |
| InChIKey | YHRHRSCKMIRYNS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |