About 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one
5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one (PubChem CID 72916924) has the molecular formula C17H26N6O
and a molecular weight of 330.44 g/mol. Its IUPAC name is 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one |
| PubChem CID | 72916924 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one |
| SMILES | CC(C)n1ccnc1Cn1ncc(N2CCCN(C)CC2)cc1=O |
| InChI | InChI=1S/C17H26N6O/c1-14(2)22-8-5-18-16(22)13-23-17(24)11-15(12-19-23)21-7-4-6-20(3)9-10-21/h5,8,11-12,14H,4,6-7,9-10,13H2,1-3H3 |
| InChIKey | JDKYCLOLYFIEBZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one?
The IUPAC name of 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one (CID 72916924) is 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one.
What is the SMILES notation for 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one?
The canonical SMILES for 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one is CC(C)n1ccnc1Cn1ncc(N2CCCN(C)CC2)cc1=O.
What is the InChIKey of 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one?
The InChIKey is JDKYCLOLYFIEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N6O/c1-14(2)22-8-5-18-16(22)13-23-17(24)11-15(12-19-23)21-7-4-6-20(3)9-10-21/h5,8,11-12,14H,4,6-7,9-10,13H2,1-3H3.
What are the key properties of 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one?
5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one has a molecular weight of 330.44 g/mol, XLogP of 1.21, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methyl-1,4-diazepan-1-yl)-2-[(1-propan-2-ylimidazol-2-yl)methyl]pyridazin-3-one is sourced from PubChem (CID 72916924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).