C14H22N4O3 — CID 72917618
5-(dimethylamino)-2-[2-(3-methoxypiperidin-1-yl)-2-oxoethyl]pyridazin-3-one (PubChem CID 72917618) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[2-(3-methoxypiperidin-1-yl)-2-oxoethyl]pyridazin-3-one.
| Compound Name | 5-(dimethylamino)-2-[2-(3-methoxypiperidin-1-yl)-2-oxoethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 72917618 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-(dimethylamino)-2-[2-(3-methoxypiperidin-1-yl)-2-oxoethyl]pyridazin-3-one |
| SMILES | COC1CCCN(C(=O)Cn2ncc(N(C)C)cc2=O)C1 |
| InChI | InChI=1S/C14H22N4O3/c1-16(2)11-7-13(19)18(15-8-11)10-14(20)17-6-4-5-12(9-17)21-3/h7-8,12H,4-6,9-10H2,1-3H3 |
| InChIKey | APTRISXPUWCHGL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |