About 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one
2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 72917938) has the molecular formula C19H31N3O3
and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one |
| PubChem CID | 72917938 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | COCCCN1CC2(CCN(Cc3cc(C(C)C)no3)CC2)CC1=O |
| InChI | InChI=1S/C19H31N3O3/c1-15(2)17-11-16(25-20-17)13-21-8-5-19(6-9-21)12-18(23)22(14-19)7-4-10-24-3/h11,15H,4-10,12-14H2,1-3H3 |
| InChIKey | CGOHDVXGRQXKIW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one?
The IUPAC name of 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one (CID 72917938) is 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one.
What is the SMILES notation for 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one?
The canonical SMILES for 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one is COCCCN1CC2(CCN(Cc3cc(C(C)C)no3)CC2)CC1=O.
What is the InChIKey of 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one?
The InChIKey is CGOHDVXGRQXKIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O3/c1-15(2)17-11-16(25-20-17)13-21-8-5-19(6-9-21)12-18(23)22(14-19)7-4-10-24-3/h11,15H,4-10,12-14H2,1-3H3.
What are the key properties of 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one?
2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one has a molecular weight of 349.48 g/mol, XLogP of 2.65, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxypropyl)-8-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2,8-diazaspiro[4.5]decan-3-one is sourced from PubChem (CID 72917938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).