About 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid
3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid (PubChem CID 72918609) has the molecular formula C20H32N4O3
and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid |
| PubChem CID | 72918609 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid |
| SMILES | CCCc1cnc(C)nc1N1CC[C@H](N2CCOCC2)[C@H](CCC(=O)O)C1 |
| InChI | InChI=1S/C20H32N4O3/c1-3-4-16-13-21-15(2)22-20(16)24-8-7-18(23-9-11-27-12-10-23)17(14-24)5-6-19(25)26/h13,17-18H,3-12,14H2,1-2H3,(H,25,26)/t17-,18+/m1/s1 |
| InChIKey | DKBDZPCBXZFZLO-MSOLQXFVSA-N |
| XLogP | 2.13 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid?
The IUPAC name of 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid (CID 72918609) is 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid.
What is the SMILES notation for 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid?
The canonical SMILES for 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid is CCCc1cnc(C)nc1N1CC[C@H](N2CCOCC2)[C@H](CCC(=O)O)C1.
What is the InChIKey of 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid?
The InChIKey is DKBDZPCBXZFZLO-MSOLQXFVSA-N. The full InChI is InChI=1S/C20H32N4O3/c1-3-4-16-13-21-15(2)22-20(16)24-8-7-18(23-9-11-27-12-10-23)17(14-24)5-6-19(25)26/h13,17-18H,3-12,14H2,1-2H3,(H,25,26)/t17-,18+/m1/s1.
What are the key properties of 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid?
3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid has a molecular weight of 376.50 g/mol, XLogP of 2.13, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4S)-1-(2-methyl-5-propylpyrimidin-4-yl)-4-morpholin-4-ylpiperidin-3-yl]propanoic acid is sourced from PubChem (CID 72918609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).