About N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide
N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide (PubChem CID 72919004) has the molecular formula C17H30N4O
and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide |
| PubChem CID | 72919004 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(C)N(C)C(=O)C1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C17H30N4O/c1-11(2)21-9-7-15(8-10-21)17(22)20(6)14(5)16-12(3)18-19-13(16)4/h11,14-15H,7-10H2,1-6H3,(H,18,19) |
| InChIKey | ZATUVLHTGZLOOF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide?
The IUPAC name of N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide (CID 72919004) is N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide.
What is the SMILES notation for N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide?
The canonical SMILES for N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide is Cc1n[nH]c(C)c1C(C)N(C)C(=O)C1CCN(C(C)C)CC1.
What is the InChIKey of N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide?
The InChIKey is ZATUVLHTGZLOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4O/c1-11(2)21-9-7-15(8-10-21)17(22)20(6)14(5)16-12(3)18-19-13(16)4/h11,14-15H,7-10H2,1-6H3,(H,18,19).
What are the key properties of N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide?
N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide has a molecular weight of 306.45 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-1-propan-2-ylpiperidine-4-carboxamide is sourced from PubChem (CID 72919004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).