C16H18N2O6 — CID 72919152
2-(1,3-benzodioxol-5-yloxymethyl)-N-(2-ethoxyethyl)-1,3-oxazole-4-carboxamide (PubChem CID 72919152) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxymethyl)-N-(2-ethoxyethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxymethyl)-N-(2-ethoxyethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 72919152 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxymethyl)-N-(2-ethoxyethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCOCCNC(=O)c1coc(COc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C16H18N2O6/c1-2-20-6-5-17-16(19)12-8-22-15(18-12)9-21-11-3-4-13-14(7-11)24-10-23-13/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,17,19) |
| InChIKey | NLQUICGJNDFGMV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|